C14H13Cl3N2O — CID 62088348
4-(chloromethyl)-5-(3,5-dichlorophenoxy)-2-propan-2-ylpyrimidine (PubChem CID 62088348) has the molecular formula C14H13Cl3N2O and a molecular weight of 331.63 g/mol. Its IUPAC name is 4-(chloromethyl)-5-(3,5-dichlorophenoxy)-2-propan-2-ylpyrimidine.
| Compound Name | 4-(chloromethyl)-5-(3,5-dichlorophenoxy)-2-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 62088348 |
| Molecular Formula | C14H13Cl3N2O |
| Molecular Weight | 331.63 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 4-(chloromethyl)-5-(3,5-dichlorophenoxy)-2-propan-2-ylpyrimidine |
| SMILES | CC(C)c1ncc(Oc2cc(Cl)cc(Cl)c2)c(CCl)n1 |
| InChI | InChI=1S/C14H13Cl3N2O/c1-8(2)14-18-7-13(12(6-15)19-14)20-11-4-9(16)3-10(17)5-11/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | FQTZIUUKINPPAD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|