C11H19N3O3S — CID 62088808
N-(2-methoxycyclopentyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 62088808) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(2-methoxycyclopentyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2-methoxycyclopentyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 62088808 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(2-methoxycyclopentyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | COC1CCCC1NS(=O)(=O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C11H19N3O3S/c1-7-11(8(2)13-12-7)18(15,16)14-9-5-4-6-10(9)17-3/h9-10,14H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | PLZUPVRAZIQVGF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |