C14H13F2NO2S — CID 62091574
methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate (PubChem CID 62091574) has the molecular formula C14H13F2NO2S and a molecular weight of 297.33 g/mol. Its IUPAC name is methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate.
| Compound Name | methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate |
|---|---|
| PubChem CID | 62091574 |
| Molecular Formula | C14H13F2NO2S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate |
| SMILES | COC(=O)c1cc(NC(C)c2ccsc2)c(F)cc1F |
| InChI | InChI=1S/C14H13F2NO2S/c1-8(9-3-4-20-7-9)17-13-5-10(14(18)19-2)11(15)6-12(13)16/h3-8,17H,1-2H3 |
| InChIKey | PRXDFSFHSBWCGB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |