methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate

C14H13F2NO2S — CID 62091574

IUPACmethyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate
SMILESCOC(=O)c1cc(NC(C)c2ccsc2)c(F)cc1F
InChIInChI=1S/C14H13F2NO2S/c1-8(9-3-4-20-7-9)17-13-5-10(14(18)19-2)11(15)6-12(13)16/h3-8,17H,1-2H3
InChIKeyPRXDFSFHSBWCGB-UHFFFAOYSA-N
MW297.33 g/mol
LogP3.99
Rot. Bonds4

About methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate

methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate (PubChem CID 62091574) has the molecular formula C14H13F2NO2S and a molecular weight of 297.33 g/mol. Its IUPAC name is methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate.

Molecular Properties

Compound Namemethyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate
PubChem CID62091574
Molecular FormulaC14H13F2NO2S
Molecular Weight297.33 g/mol
Exact Mass297.06
IUPAC Namemethyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate
SMILESCOC(=O)c1cc(NC(C)c2ccsc2)c(F)cc1F
InChIInChI=1S/C14H13F2NO2S/c1-8(9-3-4-20-7-9)17-13-5-10(14(18)19-2)11(15)6-12(13)16/h3-8,17H,1-2H3
InChIKeyPRXDFSFHSBWCGB-UHFFFAOYSA-N
XLogP3.99
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.33
LogP ≤ 53.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate?
The IUPAC name of methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate (CID 62091574) is methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate.
What is the SMILES notation for methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate?
The canonical SMILES for methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate is COC(=O)c1cc(NC(C)c2ccsc2)c(F)cc1F.
What is the InChIKey of methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate?
The InChIKey is PRXDFSFHSBWCGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2NO2S/c1-8(9-3-4-20-7-9)17-13-5-10(14(18)19-2)11(15)6-12(13)16/h3-8,17H,1-2H3.
What are the key properties of methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate?
methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate has a molecular weight of 297.33 g/mol, XLogP of 3.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-difluoro-5-(1-thiophen-3-ylethylamino)benzoate is sourced from PubChem (CID 62091574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).