C14H12BrF2NO2S — CID 107354164
methyl 5-[1-(4-bromothiophen-2-yl)ethylamino]-2,4-difluorobenzoate (PubChem CID 107354164) has the molecular formula C14H12BrF2NO2S and a molecular weight of 376.22 g/mol. Its IUPAC name is methyl 5-[1-(4-bromothiophen-2-yl)ethylamino]-2,4-difluorobenzoate.
| Compound Name | methyl 5-[1-(4-bromothiophen-2-yl)ethylamino]-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 107354164 |
| Molecular Formula | C14H12BrF2NO2S |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | methyl 5-[1-(4-bromothiophen-2-yl)ethylamino]-2,4-difluorobenzoate |
| SMILES | COC(=O)c1cc(NC(C)c2cc(Br)cs2)c(F)cc1F |
| InChI | InChI=1S/C14H12BrF2NO2S/c1-7(13-3-8(15)6-21-13)18-12-4-9(14(19)20-2)10(16)5-11(12)17/h3-7,18H,1-2H3 |
| InChIKey | NVPYDMZVUHWKML-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |