C9H16N2O2S — CID 62093159
N-(4-amino-4-sulfanylidenebutan-2-yl)oxolane-3-carboxamide (PubChem CID 62093159) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutan-2-yl)oxolane-3-carboxamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutan-2-yl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 62093159 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutan-2-yl)oxolane-3-carboxamide |
| SMILES | CC(CC(N)=S)NC(=O)C1CCOC1 |
| InChI | InChI=1S/C9H16N2O2S/c1-6(4-8(10)14)11-9(12)7-2-3-13-5-7/h6-7H,2-5H2,1H3,(H2,10,14)(H,11,12) |
| InChIKey | MNQDRWNRMRNYDI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|