C11H18F2N2OS — CID 114226310
N-(4-amino-4-sulfanylidenebutan-2-yl)-3,3-difluorocyclohexane-1-carboxamide (PubChem CID 114226310) has the molecular formula C11H18F2N2OS and a molecular weight of 264.34 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutan-2-yl)-3,3-difluorocyclohexane-1-carboxamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-3,3-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114226310 |
| Molecular Formula | C11H18F2N2OS |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-3,3-difluorocyclohexane-1-carboxamide |
| SMILES | CC(CC(N)=S)NC(=O)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C11H18F2N2OS/c1-7(5-9(14)17)15-10(16)8-3-2-4-11(12,13)6-8/h7-8H,2-6H2,1H3,(H2,14,17)(H,15,16) |
| InChIKey | ZEXXQZFATCRXJI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|