C12H22F2N2O — CID 114226715
N-(5-aminopentan-2-yl)-3,3-difluorocyclohexane-1-carboxamide (PubChem CID 114226715) has the molecular formula C12H22F2N2O and a molecular weight of 248.32 g/mol. Its IUPAC name is N-(5-aminopentan-2-yl)-3,3-difluorocyclohexane-1-carboxamide.
| Compound Name | N-(5-aminopentan-2-yl)-3,3-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114226715 |
| Molecular Formula | C12H22F2N2O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | N-(5-aminopentan-2-yl)-3,3-difluorocyclohexane-1-carboxamide |
| SMILES | CC(CCCN)NC(=O)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C12H22F2N2O/c1-9(4-3-7-15)16-11(17)10-5-2-6-12(13,14)8-10/h9-10H,2-8,15H2,1H3,(H,16,17) |
| InChIKey | RLEBNZDNLJHMHX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |