C13H24F2N2O — CID 114226716
N-(4-amino-2-ethylbutyl)-3,3-difluorocyclohexane-1-carboxamide (PubChem CID 114226716) has the molecular formula C13H24F2N2O and a molecular weight of 262.34 g/mol. Its IUPAC name is N-(4-amino-2-ethylbutyl)-3,3-difluorocyclohexane-1-carboxamide.
| Compound Name | N-(4-amino-2-ethylbutyl)-3,3-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114226716 |
| Molecular Formula | C13H24F2N2O |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | N-(4-amino-2-ethylbutyl)-3,3-difluorocyclohexane-1-carboxamide |
| SMILES | CCC(CCN)CNC(=O)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H24F2N2O/c1-2-10(5-7-16)9-17-12(18)11-4-3-6-13(14,15)8-11/h10-11H,2-9,16H2,1H3,(H,17,18) |
| InChIKey | RNZOQPHKXCMSKA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |