C9H15F2NO2 — CID 130487789
3,3-difluoro-N-(2-hydroxyethyl)cyclohexane-1-carboxamide (PubChem CID 130487789) has the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. Its IUPAC name is 3,3-difluoro-N-(2-hydroxyethyl)cyclohexane-1-carboxamide.
| Compound Name | 3,3-difluoro-N-(2-hydroxyethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 130487789 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3,3-difluoro-N-(2-hydroxyethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCCO)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C9H15F2NO2/c10-9(11)3-1-2-7(6-9)8(14)12-4-5-13/h7,13H,1-6H2,(H,12,14) |
| InChIKey | QCVCQBWKUUSBKB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |