C8H10F2N2O — CID 126974588
N-cyano-3,3-difluorocyclohexane-1-carboxamide (PubChem CID 126974588) has the molecular formula C8H10F2N2O and a molecular weight of 188.18 g/mol. Its IUPAC name is N-cyano-3,3-difluorocyclohexane-1-carboxamide.
| Compound Name | N-cyano-3,3-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 126974588 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | N-cyano-3,3-difluorocyclohexane-1-carboxamide |
| SMILES | N#CNC(=O)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C8H10F2N2O/c9-8(10)3-1-2-6(4-8)7(13)12-5-11/h6H,1-4H2,(H,12,13) |
| InChIKey | WVJHRIACGUWJQT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|