C11H15F2NO — CID 177192865
(1S)-N-buta-1,3-dien-2-yl-3,3-difluorocyclohexane-1-carboxamide (PubChem CID 177192865) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is (1S)-N-buta-1,3-dien-2-yl-3,3-difluorocyclohexane-1-carboxamide.
| Compound Name | (1S)-N-buta-1,3-dien-2-yl-3,3-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 177192865 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (1S)-N-buta-1,3-dien-2-yl-3,3-difluorocyclohexane-1-carboxamide |
| SMILES | C=CC(=C)NC(=O)[C@H]1CCCC(F)(F)C1 |
| InChI | InChI=1S/C11H15F2NO/c1-3-8(2)14-10(15)9-5-4-6-11(12,13)7-9/h3,9H,1-2,4-7H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | SNRAOXZTNWPVOQ-VIFPVBQESA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|