C12H15F2NO3 — CID 114226223
2-[(3,3-difluorocyclohexanecarbonyl)amino]pent-4-ynoic acid (PubChem CID 114226223) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclohexanecarbonyl)amino]pent-4-ynoic acid.
| Compound Name | 2-[(3,3-difluorocyclohexanecarbonyl)amino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 114226223 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-[(3,3-difluorocyclohexanecarbonyl)amino]pent-4-ynoic acid |
| SMILES | C#CCC(NC(=O)C1CCCC(F)(F)C1)C(=O)O |
| InChI | InChI=1S/C12H15F2NO3/c1-2-4-9(11(17)18)15-10(16)8-5-3-6-12(13,14)7-8/h1,8-9H,3-7H2,(H,15,16)(H,17,18) |
| InChIKey | ZPYSWMDCQZAQRG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|