C11H15NO5S — CID 113421891
2-[(1,1-dioxothiane-2-carbonyl)amino]pent-4-ynoic acid (PubChem CID 113421891) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-[(1,1-dioxothiane-2-carbonyl)amino]pent-4-ynoic acid.
| Compound Name | 2-[(1,1-dioxothiane-2-carbonyl)amino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 113421891 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-[(1,1-dioxothiane-2-carbonyl)amino]pent-4-ynoic acid |
| SMILES | C#CCC(NC(=O)C1CCCCS1(=O)=O)C(=O)O |
| InChI | InChI=1S/C11H15NO5S/c1-2-5-8(11(14)15)12-10(13)9-6-3-4-7-18(9,16)17/h1,8-9H,3-7H2,(H,12,13)(H,14,15) |
| InChIKey | XYAWTFFIAJRYBK-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|