C15H24N2O3 — CID 62094732
2-amino-N-hexan-3-yl-4,5-dimethoxybenzamide (PubChem CID 62094732) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-amino-N-hexan-3-yl-4,5-dimethoxybenzamide.
| Compound Name | 2-amino-N-hexan-3-yl-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 62094732 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-amino-N-hexan-3-yl-4,5-dimethoxybenzamide |
| SMILES | CCCC(CC)NC(=O)c1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C15H24N2O3/c1-5-7-10(6-2)17-15(18)11-8-13(19-3)14(20-4)9-12(11)16/h8-10H,5-7,16H2,1-4H3,(H,17,18) |
| InChIKey | FUXOEEDYMBEXCH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|