C12H19N3 — CID 62095660
N-methyl-1-(1-methyl-2,3-dihydroindol-5-yl)ethane-1,2-diamine (PubChem CID 62095660) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is N-methyl-1-(1-methyl-2,3-dihydroindol-5-yl)ethane-1,2-diamine.
| Compound Name | N-methyl-1-(1-methyl-2,3-dihydroindol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62095660 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-methyl-1-(1-methyl-2,3-dihydroindol-5-yl)ethane-1,2-diamine |
| SMILES | CNC(CN)c1ccc2c(c1)CCN2C |
| InChI | InChI=1S/C12H19N3/c1-14-11(8-13)9-3-4-12-10(7-9)5-6-15(12)2/h3-4,7,11,14H,5-6,8,13H2,1-2H3 |
| InChIKey | ZBMQXACBNXHCDM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|