C18H29N3 — CID 63624247
2-(4-methylazepan-1-yl)-2-(1-methyl-2,3-dihydroindol-5-yl)ethanamine (PubChem CID 63624247) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-(4-methylazepan-1-yl)-2-(1-methyl-2,3-dihydroindol-5-yl)ethanamine.
| Compound Name | 2-(4-methylazepan-1-yl)-2-(1-methyl-2,3-dihydroindol-5-yl)ethanamine |
|---|---|
| PubChem CID | 63624247 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 2-(4-methylazepan-1-yl)-2-(1-methyl-2,3-dihydroindol-5-yl)ethanamine |
| SMILES | CC1CCCN(C(CN)c2ccc3c(c2)CCN3C)CC1 |
| InChI | InChI=1S/C18H29N3/c1-14-4-3-9-21(11-7-14)18(13-19)15-5-6-17-16(12-15)8-10-20(17)2/h5-6,12,14,18H,3-4,7-11,13,19H2,1-2H3 |
| InChIKey | UKHDRUUHWQKKJZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|