C12H14ClN3O — CID 62098241
3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-methylpropan-1-amine (PubChem CID 62098241) has the molecular formula C12H14ClN3O and a molecular weight of 251.72 g/mol. Its IUPAC name is 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 62098241 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCc1nc(-c2ccccc2Cl)no1 |
| InChI | InChI=1S/C12H14ClN3O/c1-14-8-4-7-11-15-12(16-17-11)9-5-2-3-6-10(9)13/h2-3,5-6,14H,4,7-8H2,1H3 |
| InChIKey | DYBUMSRCTLFGTG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|