C12H12N6O2 — CID 62099217
2-[2-(1-methylimidazol-2-yl)ethylamino]-5-nitropyridine-3-carbonitrile (PubChem CID 62099217) has the molecular formula C12H12N6O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-[2-(1-methylimidazol-2-yl)ethylamino]-5-nitropyridine-3-carbonitrile.
| Compound Name | 2-[2-(1-methylimidazol-2-yl)ethylamino]-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 62099217 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[2-(1-methylimidazol-2-yl)ethylamino]-5-nitropyridine-3-carbonitrile |
| SMILES | Cn1ccnc1CCNc1ncc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C12H12N6O2/c1-17-5-4-14-11(17)2-3-15-12-9(7-13)6-10(8-16-12)18(19)20/h4-6,8H,2-3H2,1H3,(H,15,16) |
| InChIKey | OHUZKAWMRBTQMV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|