C11H14ClNO3 — CID 62100784
1-(4-chloro-2-nitrophenyl)pentan-3-ol (PubChem CID 62100784) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 1-(4-chloro-2-nitrophenyl)pentan-3-ol.
| Compound Name | 1-(4-chloro-2-nitrophenyl)pentan-3-ol |
|---|---|
| PubChem CID | 62100784 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-(4-chloro-2-nitrophenyl)pentan-3-ol |
| SMILES | CCC(O)CCc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14ClNO3/c1-2-10(14)6-4-8-3-5-9(12)7-11(8)13(15)16/h3,5,7,10,14H,2,4,6H2,1H3 |
| InChIKey | QLAMPBKVBWTMIY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|