C13H15BrN2S — CID 62100839
2-N-[(3-bromothiophen-2-yl)methyl]-2-N-ethylbenzene-1,2-diamine (PubChem CID 62100839) has the molecular formula C13H15BrN2S and a molecular weight of 311.25 g/mol. Its IUPAC name is 2-N-[(3-bromothiophen-2-yl)methyl]-2-N-ethylbenzene-1,2-diamine.
| Compound Name | 2-N-[(3-bromothiophen-2-yl)methyl]-2-N-ethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 62100839 |
| Molecular Formula | C13H15BrN2S |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-N-[(3-bromothiophen-2-yl)methyl]-2-N-ethylbenzene-1,2-diamine |
| SMILES | CCN(Cc1sccc1Br)c1ccccc1N |
| InChI | InChI=1S/C13H15BrN2S/c1-2-16(9-13-10(14)7-8-17-13)12-6-4-3-5-11(12)15/h3-8H,2,9,15H2,1H3 |
| InChIKey | OFIRMPQEXADSQY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|