C23H16Br2INO4 — CID 6210119
(E)-2-benzamido-3-[3,5-dibromo-4-[(3-iodophenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 6210119) has the molecular formula C23H16Br2INO4 and a molecular weight of 657.10 g/mol. Its IUPAC name is (E)-2-benzamido-3-[3,5-dibromo-4-[(3-iodophenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-benzamido-3-[3,5-dibromo-4-[(3-iodophenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6210119 |
| Molecular Formula | C23H16Br2INO4 |
| Molecular Weight | 657.10 g/mol |
| Exact Mass | 654.85 |
| IUPAC Name | (E)-2-benzamido-3-[3,5-dibromo-4-[(3-iodophenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1cc(Br)c(OCc2cccc(I)c2)c(Br)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H16Br2INO4/c24-18-10-15(11-19(25)21(18)31-13-14-5-4-8-17(26)9-14)12-20(23(29)30)27-22(28)16-6-2-1-3-7-16/h1-12H,13H2,(H,27,28)(H,29,30)/b20-12+ |
| InChIKey | ZQWXMRRTUYRORA-UDWIEESQSA-N |
| XLogP | 6.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.10 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|