C14H14FNO4S — CID 62104803
5-fluoro-2-[(2-methoxyphenyl)methoxy]benzenesulfonamide (PubChem CID 62104803) has the molecular formula C14H14FNO4S and a molecular weight of 311.33 g/mol. Its IUPAC name is 5-fluoro-2-[(2-methoxyphenyl)methoxy]benzenesulfonamide.
| Compound Name | 5-fluoro-2-[(2-methoxyphenyl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 62104803 |
| Molecular Formula | C14H14FNO4S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 5-fluoro-2-[(2-methoxyphenyl)methoxy]benzenesulfonamide |
| SMILES | COc1ccccc1COc1ccc(F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H14FNO4S/c1-19-12-5-3-2-4-10(12)9-20-13-7-6-11(15)8-14(13)21(16,17)18/h2-8H,9H2,1H3,(H2,16,17,18) |
| InChIKey | OELMMAQHYTUTKO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |