C14H17FN4O2 — CID 62111533
2-(3-aminopyrazol-1-yl)-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylacetamide (PubChem CID 62111533) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is 2-(3-aminopyrazol-1-yl)-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylacetamide.
| Compound Name | 2-(3-aminopyrazol-1-yl)-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 62111533 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(3-aminopyrazol-1-yl)-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylacetamide |
| SMILES | COc1ccc(CN(C)C(=O)Cn2ccc(N)n2)cc1F |
| InChI | InChI=1S/C14H17FN4O2/c1-18(14(20)9-19-6-5-13(16)17-19)8-10-3-4-12(21-2)11(15)7-10/h3-7H,8-9H2,1-2H3,(H2,16,17) |
| InChIKey | RDOMUCHAOKERFI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |