C13H22N4O3 — CID 62111923
[1-(3-methylbutylamino)-1-oxopropan-2-yl] 2-(3-aminopyrazol-1-yl)acetate (PubChem CID 62111923) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is [1-(3-methylbutylamino)-1-oxopropan-2-yl] 2-(3-aminopyrazol-1-yl)acetate.
| Compound Name | [1-(3-methylbutylamino)-1-oxopropan-2-yl] 2-(3-aminopyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 62111923 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | [1-(3-methylbutylamino)-1-oxopropan-2-yl] 2-(3-aminopyrazol-1-yl)acetate |
| SMILES | CC(C)CCNC(=O)C(C)OC(=O)Cn1ccc(N)n1 |
| InChI | InChI=1S/C13H22N4O3/c1-9(2)4-6-15-13(19)10(3)20-12(18)8-17-7-5-11(14)16-17/h5,7,9-10H,4,6,8H2,1-3H3,(H2,14,16)(H,15,19) |
| InChIKey | LEQYWBGVZCJDJH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |