C12H20N4O3 — CID 62114107
[1-(butan-2-ylamino)-1-oxopropan-2-yl] 2-(3-aminopyrazol-1-yl)acetate (PubChem CID 62114107) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is [1-(butan-2-ylamino)-1-oxopropan-2-yl] 2-(3-aminopyrazol-1-yl)acetate.
| Compound Name | [1-(butan-2-ylamino)-1-oxopropan-2-yl] 2-(3-aminopyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 62114107 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [1-(butan-2-ylamino)-1-oxopropan-2-yl] 2-(3-aminopyrazol-1-yl)acetate |
| SMILES | CCC(C)NC(=O)C(C)OC(=O)Cn1ccc(N)n1 |
| InChI | InChI=1S/C12H20N4O3/c1-4-8(2)14-12(18)9(3)19-11(17)7-16-6-5-10(13)15-16/h5-6,8-9H,4,7H2,1-3H3,(H2,13,15)(H,14,18) |
| InChIKey | OYKJJCVQDUBKQY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |