C15H28N4O — CID 62113064
2-(3-aminopyrazol-1-yl)-N,N-dipentylacetamide (PubChem CID 62113064) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-(3-aminopyrazol-1-yl)-N,N-dipentylacetamide.
| Compound Name | 2-(3-aminopyrazol-1-yl)-N,N-dipentylacetamide |
|---|---|
| PubChem CID | 62113064 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 2-(3-aminopyrazol-1-yl)-N,N-dipentylacetamide |
| SMILES | CCCCCN(CCCCC)C(=O)Cn1ccc(N)n1 |
| InChI | InChI=1S/C15H28N4O/c1-3-5-7-10-18(11-8-6-4-2)15(20)13-19-12-9-14(16)17-19/h9,12H,3-8,10-11,13H2,1-2H3,(H2,16,17) |
| InChIKey | JMRCANPHTKEQOW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|