C11H22N4 — CID 63318061
1-[2-[methyl(pentyl)amino]ethyl]pyrazol-3-amine (PubChem CID 63318061) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-[2-[methyl(pentyl)amino]ethyl]pyrazol-3-amine.
| Compound Name | 1-[2-[methyl(pentyl)amino]ethyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 63318061 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 1-[2-[methyl(pentyl)amino]ethyl]pyrazol-3-amine |
| SMILES | CCCCCN(C)CCn1ccc(N)n1 |
| InChI | InChI=1S/C11H22N4/c1-3-4-5-7-14(2)9-10-15-8-6-11(12)13-15/h6,8H,3-5,7,9-10H2,1-2H3,(H2,12,13) |
| InChIKey | INIONJNVQHOUMR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|