C11H22N4O — CID 63316054
2-[2-(3-aminopyrazol-1-yl)ethyl-butylamino]ethanol (PubChem CID 63316054) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-[2-(3-aminopyrazol-1-yl)ethyl-butylamino]ethanol.
| Compound Name | 2-[2-(3-aminopyrazol-1-yl)ethyl-butylamino]ethanol |
|---|---|
| PubChem CID | 63316054 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 2-[2-(3-aminopyrazol-1-yl)ethyl-butylamino]ethanol |
| SMILES | CCCCN(CCO)CCn1ccc(N)n1 |
| InChI | InChI=1S/C11H22N4O/c1-2-3-5-14(9-10-16)7-8-15-6-4-11(12)13-15/h4,6,16H,2-3,5,7-10H2,1H3,(H2,12,13) |
| InChIKey | ZSUYGQSWTBKTLZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |