C12H23N3O — CID 62013858
2-[butyl-[2-(2-methylimidazol-1-yl)ethyl]amino]ethanol (PubChem CID 62013858) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 2-[butyl-[2-(2-methylimidazol-1-yl)ethyl]amino]ethanol.
| Compound Name | 2-[butyl-[2-(2-methylimidazol-1-yl)ethyl]amino]ethanol |
|---|---|
| PubChem CID | 62013858 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 2-[butyl-[2-(2-methylimidazol-1-yl)ethyl]amino]ethanol |
| SMILES | CCCCN(CCO)CCn1ccnc1C |
| InChI | InChI=1S/C12H23N3O/c1-3-4-6-14(10-11-16)8-9-15-7-5-13-12(15)2/h5,7,16H,3-4,6,8-11H2,1-2H3 |
| InChIKey | YCIRALOQWDMFGM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |