C13H15N3O2 — CID 62113235
2-phenylethyl 2-(3-aminopyrazol-1-yl)acetate (PubChem CID 62113235) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-phenylethyl 2-(3-aminopyrazol-1-yl)acetate.
| Compound Name | 2-phenylethyl 2-(3-aminopyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 62113235 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-phenylethyl 2-(3-aminopyrazol-1-yl)acetate |
| SMILES | Nc1ccn(CC(=O)OCCc2ccccc2)n1 |
| InChI | InChI=1S/C13H15N3O2/c14-12-6-8-16(15-12)10-13(17)18-9-7-11-4-2-1-3-5-11/h1-6,8H,7,9-10H2,(H2,14,15) |
| InChIKey | UIFGSIATPRRPCD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |