C14H14F3NS — CID 62114391
N-methyl-1-thiophen-3-yl-2-[4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 62114391) has the molecular formula C14H14F3NS and a molecular weight of 285.33 g/mol. Its IUPAC name is N-methyl-1-thiophen-3-yl-2-[4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-methyl-1-thiophen-3-yl-2-[4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 62114391 |
| Molecular Formula | C14H14F3NS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-methyl-1-thiophen-3-yl-2-[4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CNC(Cc1ccc(C(F)(F)F)cc1)c1ccsc1 |
| InChI | InChI=1S/C14H14F3NS/c1-18-13(11-6-7-19-9-11)8-10-2-4-12(5-3-10)14(15,16)17/h2-7,9,13,18H,8H2,1H3 |
| InChIKey | UKBFXOACOIODBZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |