C13H14FNS — CID 60820385
2-(2-fluorophenyl)-N-methyl-1-thiophen-3-ylethanamine (PubChem CID 60820385) has the molecular formula C13H14FNS and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-methyl-1-thiophen-3-ylethanamine.
| Compound Name | 2-(2-fluorophenyl)-N-methyl-1-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 60820385 |
| Molecular Formula | C13H14FNS |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-(2-fluorophenyl)-N-methyl-1-thiophen-3-ylethanamine |
| SMILES | CNC(Cc1ccccc1F)c1ccsc1 |
| InChI | InChI=1S/C13H14FNS/c1-15-13(11-6-7-16-9-11)8-10-4-2-3-5-12(10)14/h2-7,9,13,15H,8H2,1H3 |
| InChIKey | LDSVCVMVBMNNDC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |