C15H17F2NS — CID 55095017
N-[2-(2,3-difluorophenyl)-1-thiophen-3-ylethyl]propan-1-amine (PubChem CID 55095017) has the molecular formula C15H17F2NS and a molecular weight of 281.37 g/mol. Its IUPAC name is N-[2-(2,3-difluorophenyl)-1-thiophen-3-ylethyl]propan-1-amine.
| Compound Name | N-[2-(2,3-difluorophenyl)-1-thiophen-3-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 55095017 |
| Molecular Formula | C15H17F2NS |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[2-(2,3-difluorophenyl)-1-thiophen-3-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cccc(F)c1F)c1ccsc1 |
| InChI | InChI=1S/C15H17F2NS/c1-2-7-18-14(12-6-8-19-10-12)9-11-4-3-5-13(16)15(11)17/h3-6,8,10,14,18H,2,7,9H2,1H3 |
| InChIKey | MKIWRNDSNUGVST-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |