C15H18INS — CID 65477900
N-[2-(4-iodophenyl)-1-thiophen-3-ylethyl]propan-1-amine (PubChem CID 65477900) has the molecular formula C15H18INS and a molecular weight of 371.29 g/mol. Its IUPAC name is N-[2-(4-iodophenyl)-1-thiophen-3-ylethyl]propan-1-amine.
| Compound Name | N-[2-(4-iodophenyl)-1-thiophen-3-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 65477900 |
| Molecular Formula | C15H18INS |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | N-[2-(4-iodophenyl)-1-thiophen-3-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(I)cc1)c1ccsc1 |
| InChI | InChI=1S/C15H18INS/c1-2-8-17-15(13-7-9-18-11-13)10-12-3-5-14(16)6-4-12/h3-7,9,11,15,17H,2,8,10H2,1H3 |
| InChIKey | MMQXJJCVBCCMDA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|