C14H21N3S — CID 62126619
N-[2-(1-ethylpyrazol-4-yl)-1-thiophen-3-ylethyl]propan-1-amine (PubChem CID 62126619) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-[2-(1-ethylpyrazol-4-yl)-1-thiophen-3-ylethyl]propan-1-amine.
| Compound Name | N-[2-(1-ethylpyrazol-4-yl)-1-thiophen-3-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 62126619 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-[2-(1-ethylpyrazol-4-yl)-1-thiophen-3-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cnn(CC)c1)c1ccsc1 |
| InChI | InChI=1S/C14H21N3S/c1-3-6-15-14(13-5-7-18-11-13)8-12-9-16-17(4-2)10-12/h5,7,9-11,14-15H,3-4,6,8H2,1-2H3 |
| InChIKey | SSCBHZFRYQUYKC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |