C14H21NO3 — CID 62115597
1-[2-(aminomethyl)phenoxy]-3-cyclobutyloxypropan-2-ol (PubChem CID 62115597) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[2-(aminomethyl)phenoxy]-3-cyclobutyloxypropan-2-ol.
| Compound Name | 1-[2-(aminomethyl)phenoxy]-3-cyclobutyloxypropan-2-ol |
|---|---|
| PubChem CID | 62115597 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-[2-(aminomethyl)phenoxy]-3-cyclobutyloxypropan-2-ol |
| SMILES | NCc1ccccc1OCC(O)COC1CCC1 |
| InChI | InChI=1S/C14H21NO3/c15-8-11-4-1-2-7-14(11)18-10-12(16)9-17-13-5-3-6-13/h1-2,4,7,12-13,16H,3,5-6,8-10,15H2 |
| InChIKey | OUTKKJGTPKFGEZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |