C14H16N6 — CID 62118261
6-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]quinoline-5,6-diamine (PubChem CID 62118261) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is 6-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]quinoline-5,6-diamine.
| Compound Name | 6-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]quinoline-5,6-diamine |
|---|---|
| PubChem CID | 62118261 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 6-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]quinoline-5,6-diamine |
| SMILES | CC(Nc1ccc2ncccc2c1N)c1nncn1C |
| InChI | InChI=1S/C14H16N6/c1-9(14-19-17-8-20(14)2)18-12-6-5-11-10(13(12)15)4-3-7-16-11/h3-9,18H,15H2,1-2H3 |
| InChIKey | AGDRYJWPJLYRPS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|