C13H17N5 — CID 62118327
2-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-dihydroisoindol-5-amine (PubChem CID 62118327) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-dihydroisoindol-5-amine.
| Compound Name | 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-dihydroisoindol-5-amine |
|---|---|
| PubChem CID | 62118327 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-dihydroisoindol-5-amine |
| SMILES | CC(c1nncn1C)N1Cc2ccc(N)cc2C1 |
| InChI | InChI=1S/C13H17N5/c1-9(13-16-15-8-17(13)2)18-6-10-3-4-12(14)5-11(10)7-18/h3-5,8-9H,6-7,14H2,1-2H3 |
| InChIKey | MGBXOVSGKOEIAM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|