C13H21NO — CID 62118767
1-hexan-3-yl-2,5-dimethylpyrrole-3-carbaldehyde (PubChem CID 62118767) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-hexan-3-yl-2,5-dimethylpyrrole-3-carbaldehyde.
| Compound Name | 1-hexan-3-yl-2,5-dimethylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 62118767 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-hexan-3-yl-2,5-dimethylpyrrole-3-carbaldehyde |
| SMILES | CCCC(CC)n1c(C)cc(C=O)c1C |
| InChI | InChI=1S/C13H21NO/c1-5-7-13(6-2)14-10(3)8-12(9-15)11(14)4/h8-9,13H,5-7H2,1-4H3 |
| InChIKey | JGEOGHDSVCNCBI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|