C11H14FN5O2S — CID 62119723
2-amino-5-fluoro-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzenesulfonamide (PubChem CID 62119723) has the molecular formula C11H14FN5O2S and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-amino-5-fluoro-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-5-fluoro-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62119723 |
| Molecular Formula | C11H14FN5O2S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-amino-5-fluoro-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(F)ccc1N)c1nncn1C |
| InChI | InChI=1S/C11H14FN5O2S/c1-7(11-15-14-6-17(11)2)16-20(18,19)10-5-8(12)3-4-9(10)13/h3-7,16H,13H2,1-2H3 |
| InChIKey | PEZSBGWQNZEXDD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|