C12H17N5O3S — CID 62056450
4-amino-2-methoxy-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzenesulfonamide (PubChem CID 62056450) has the molecular formula C12H17N5O3S and a molecular weight of 311.37 g/mol. Its IUPAC name is 4-amino-2-methoxy-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-amino-2-methoxy-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62056450 |
| Molecular Formula | C12H17N5O3S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-amino-2-methoxy-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzenesulfonamide |
| SMILES | COc1cc(N)ccc1S(=O)(=O)NC(C)c1nncn1C |
| InChI | InChI=1S/C12H17N5O3S/c1-8(12-15-14-7-17(12)2)16-21(18,19)11-5-4-9(13)6-10(11)20-3/h4-8,16H,13H2,1-3H3 |
| InChIKey | HDOXLIZNHFHERN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|