About 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline
4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline (PubChem CID 62121037) has the molecular formula C18H26N2O
and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline.
Molecular Properties
| Compound Name | 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline |
| PubChem CID | 62121037 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline |
| SMILES | Cc1cc(CNC(C)(C)C)ccc1N(C)Cc1ccoc1 |
| InChI | InChI=1S/C18H26N2O/c1-14-10-15(11-19-18(2,3)4)6-7-17(14)20(5)12-16-8-9-21-13-16/h6-10,13,19H,11-12H2,1-5H3 |
| InChIKey | QWQCVRHXSJMXTO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline?
The IUPAC name of 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline (CID 62121037) is 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline.
What is the SMILES notation for 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline?
The canonical SMILES for 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline is Cc1cc(CNC(C)(C)C)ccc1N(C)Cc1ccoc1.
What is the InChIKey of 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline?
The InChIKey is QWQCVRHXSJMXTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O/c1-14-10-15(11-19-18(2,3)4)6-7-17(14)20(5)12-16-8-9-21-13-16/h6-10,13,19H,11-12H2,1-5H3.
What are the key properties of 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline?
4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline has a molecular weight of 286.42 g/mol, XLogP of 4.11, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(tert-butylamino)methyl]-N-(furan-3-ylmethyl)-N,2-dimethylaniline is sourced from PubChem (CID 62121037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).