C16H28N2O2S — CID 79843635
4-[(tert-butylamino)methyl]-N,2-dimethyl-N-(2-methylsulfonylethyl)aniline (PubChem CID 79843635) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 4-[(tert-butylamino)methyl]-N,2-dimethyl-N-(2-methylsulfonylethyl)aniline.
| Compound Name | 4-[(tert-butylamino)methyl]-N,2-dimethyl-N-(2-methylsulfonylethyl)aniline |
|---|---|
| PubChem CID | 79843635 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 4-[(tert-butylamino)methyl]-N,2-dimethyl-N-(2-methylsulfonylethyl)aniline |
| SMILES | Cc1cc(CNC(C)(C)C)ccc1N(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C16H28N2O2S/c1-13-11-14(12-17-16(2,3)4)7-8-15(13)18(5)9-10-21(6,19)20/h7-8,11,17H,9-10,12H2,1-6H3 |
| InChIKey | POSPKFCVJPYDKK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|