C9H10F3NO2 — CID 62121414
5-[ethyl(2,2,2-trifluoroethyl)amino]furan-2-carbaldehyde (PubChem CID 62121414) has the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. Its IUPAC name is 5-[ethyl(2,2,2-trifluoroethyl)amino]furan-2-carbaldehyde.
| Compound Name | 5-[ethyl(2,2,2-trifluoroethyl)amino]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 62121414 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 5-[ethyl(2,2,2-trifluoroethyl)amino]furan-2-carbaldehyde |
| SMILES | CCN(CC(F)(F)F)c1ccc(C=O)o1 |
| InChI | InChI=1S/C9H10F3NO2/c1-2-13(6-9(10,11)12)8-4-3-7(5-14)15-8/h3-5H,2,6H2,1H3 |
| InChIKey | KXAGEIWEQIFDCD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|