C12H24N2S — CID 62122843
3-(2,3-dimethylpiperidin-1-yl)pentanethioamide (PubChem CID 62122843) has the molecular formula C12H24N2S and a molecular weight of 228.40 g/mol. Its IUPAC name is 3-(2,3-dimethylpiperidin-1-yl)pentanethioamide.
| Compound Name | 3-(2,3-dimethylpiperidin-1-yl)pentanethioamide |
|---|---|
| PubChem CID | 62122843 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 3-(2,3-dimethylpiperidin-1-yl)pentanethioamide |
| SMILES | CCC(CC(N)=S)N1CCCC(C)C1C |
| InChI | InChI=1S/C12H24N2S/c1-4-11(8-12(13)15)14-7-5-6-9(2)10(14)3/h9-11H,4-8H2,1-3H3,(H2,13,15) |
| InChIKey | DNYMCJPUYQPJAQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|