C13H28N2S — CID 116504084
2-(2,3-dimethylpiperidin-1-yl)-4-ethylsulfanylbutan-1-amine (PubChem CID 116504084) has the molecular formula C13H28N2S and a molecular weight of 244.45 g/mol. Its IUPAC name is 2-(2,3-dimethylpiperidin-1-yl)-4-ethylsulfanylbutan-1-amine.
| Compound Name | 2-(2,3-dimethylpiperidin-1-yl)-4-ethylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 116504084 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 2-(2,3-dimethylpiperidin-1-yl)-4-ethylsulfanylbutan-1-amine |
| SMILES | CCSCCC(CN)N1CCCC(C)C1C |
| InChI | InChI=1S/C13H28N2S/c1-4-16-9-7-13(10-14)15-8-5-6-11(2)12(15)3/h11-13H,4-10,14H2,1-3H3 |
| InChIKey | FWIUYFHAPCZVBF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|