C12H26N2OS — CID 116503923
2-(2,6-dimethylmorpholin-4-yl)-4-ethylsulfanylbutan-1-amine (PubChem CID 116503923) has the molecular formula C12H26N2OS and a molecular weight of 246.42 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-4-ethylsulfanylbutan-1-amine.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-4-ethylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 116503923 |
| Molecular Formula | C12H26N2OS |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-4-ethylsulfanylbutan-1-amine |
| SMILES | CCSCCC(CN)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C12H26N2OS/c1-4-16-6-5-12(7-13)14-8-10(2)15-11(3)9-14/h10-12H,4-9,13H2,1-3H3 |
| InChIKey | XXVSFTNEFIDPSL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|