C13H28N2S2 — CID 107454162
2-(7,7-dimethyl-1,4-thiazepan-4-yl)-4-ethylsulfanylbutan-1-amine (PubChem CID 107454162) has the molecular formula C13H28N2S2 and a molecular weight of 276.51 g/mol. Its IUPAC name is 2-(7,7-dimethyl-1,4-thiazepan-4-yl)-4-ethylsulfanylbutan-1-amine.
| Compound Name | 2-(7,7-dimethyl-1,4-thiazepan-4-yl)-4-ethylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 107454162 |
| Molecular Formula | C13H28N2S2 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-(7,7-dimethyl-1,4-thiazepan-4-yl)-4-ethylsulfanylbutan-1-amine |
| SMILES | CCSCCC(CN)N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C13H28N2S2/c1-4-16-9-5-12(11-14)15-7-6-13(2,3)17-10-8-15/h12H,4-11,14H2,1-3H3 |
| InChIKey | GEMHWSJNFHIBPZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|