C12H13F2N3 — CID 62126805
1-(3,4-difluorophenyl)-2-(1-methylpyrazol-4-yl)ethanamine (PubChem CID 62126805) has the molecular formula C12H13F2N3 and a molecular weight of 237.25 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-(1-methylpyrazol-4-yl)ethanamine.
| Compound Name | 1-(3,4-difluorophenyl)-2-(1-methylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 62126805 |
| Molecular Formula | C12H13F2N3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-(1-methylpyrazol-4-yl)ethanamine |
| SMILES | Cn1cc(CC(N)c2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C12H13F2N3/c1-17-7-8(6-16-17)4-12(15)9-2-3-10(13)11(14)5-9/h2-3,5-7,12H,4,15H2,1H3 |
| InChIKey | FYLOCVBAAZAFQW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |