C16H23N3 — CID 62127656
1-(1-ethylpyrazol-4-yl)-2-phenylpentan-2-amine (PubChem CID 62127656) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-(1-ethylpyrazol-4-yl)-2-phenylpentan-2-amine.
| Compound Name | 1-(1-ethylpyrazol-4-yl)-2-phenylpentan-2-amine |
|---|---|
| PubChem CID | 62127656 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 1-(1-ethylpyrazol-4-yl)-2-phenylpentan-2-amine |
| SMILES | CCCC(N)(Cc1cnn(CC)c1)c1ccccc1 |
| InChI | InChI=1S/C16H23N3/c1-3-10-16(17,15-8-6-5-7-9-15)11-14-12-18-19(4-2)13-14/h5-9,12-13H,3-4,10-11,17H2,1-2H3 |
| InChIKey | OCODDHLFAXSBNB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |